C20H25N5O6S — CID 136998793
2,6-dimethoxy-4-[(E)-[(4-morpholin-4-yl-6,6-dioxo-7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidin-2-yl)hydrazinylidene]methyl]phenol (PubChem CID 136998793) has the molecular formula C20H25N5O6S and a molecular weight of 463.52 g/mol. Its IUPAC name is 2,6-dimethoxy-4-[(E)-[(4-morpholin-4-yl-6,6-dioxo-7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidin-2-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 2,6-dimethoxy-4-[(E)-[(4-morpholin-4-yl-6,6-dioxo-7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidin-2-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 136998793 |
| Molecular Formula | C20H25N5O6S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | 2,6-dimethoxy-4-[(E)-[(4-morpholin-4-yl-6,6-dioxo-7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidin-2-yl)hydrazinylidene]methyl]phenol |
| SMILES | COc1cc(/C=N/Nc2nc3c(c(N4CCOCC4)n2)CS(=O)(=O)CC3)cc(OC)c1O |
| InChI | InChI=1S/C20H25N5O6S/c1-29-16-9-13(10-17(30-2)18(16)26)11-21-24-20-22-15-3-8-32(27,28)12-14(15)19(23-20)25-4-6-31-7-5-25/h9-11,26H,3-8,12H2,1-2H3,(H,22,23,24)/b21-11+ |
| InChIKey | HENGOSXRXDHGSQ-SRZZPIQSSA-N |
| XLogP | 0.95 |
| TPSA | 135.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|