C20H5Cl2F7N2O3 — CID 86573181
(4Z)-4-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-2-(2,3,5,6-tetrafluorophenyl)-5-(trifluoromethyl)pyrazol-3-one (PubChem CID 86573181) has the molecular formula C20H5Cl2F7N2O3 and a molecular weight of 525.16 g/mol. Its IUPAC name is (4Z)-4-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-2-(2,3,5,6-tetrafluorophenyl)-5-(trifluoromethyl)pyrazol-3-one.
| Compound Name | (4Z)-4-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-2-(2,3,5,6-tetrafluorophenyl)-5-(trifluoromethyl)pyrazol-3-one |
|---|---|
| PubChem CID | 86573181 |
| Molecular Formula | C20H5Cl2F7N2O3 |
| Molecular Weight | 525.16 g/mol |
| Exact Mass | 523.96 |
| IUPAC Name | (4Z)-4-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-2-(2,3,5,6-tetrafluorophenyl)-5-(trifluoromethyl)pyrazol-3-one |
| SMILES | O=C1/C(=C\c2coc3c(Cl)cc(Cl)cc3c2=O)C(C(F)(F)F)=NN1c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C20H5Cl2F7N2O3/c21-7-2-8-16(32)6(5-34-17(8)10(22)3-7)1-9-18(20(27,28)29)30-31(19(9)33)15-13(25)11(23)4-12(24)14(15)26/h1-5H/b9-1- |
| InChIKey | JRIWDNWRCKRMHP-OQYWKCLKSA-N |
| XLogP | 6.00 |
| TPSA | 62.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.16 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|