C12H12BrClN4O3S — CID 86581034
5-bromo-N-(5-chloro-3-hydroxy-2-pyridinyl)-6-(dimethylamino)pyridine-3-sulfonamide (PubChem CID 86581034) has the molecular formula C12H12BrClN4O3S and a molecular weight of 407.68 g/mol. Its IUPAC name is 5-bromo-N-(5-chloro-3-hydroxy-2-pyridinyl)-6-(dimethylamino)pyridine-3-sulfonamide.
| Compound Name | 5-bromo-N-(5-chloro-3-hydroxy-2-pyridinyl)-6-(dimethylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 86581034 |
| Molecular Formula | C12H12BrClN4O3S |
| Molecular Weight | 407.68 g/mol |
| Exact Mass | 405.95 |
| IUPAC Name | 5-bromo-N-(5-chloro-3-hydroxy-2-pyridinyl)-6-(dimethylamino)pyridine-3-sulfonamide |
| SMILES | CN(C)c1ncc(S(=O)(=O)Nc2ncc(Cl)cc2O)cc1Br |
| InChI | InChI=1S/C12H12BrClN4O3S/c1-18(2)12-9(13)4-8(6-16-12)22(20,21)17-11-10(19)3-7(14)5-15-11/h3-6,19H,1-2H3,(H,15,17) |
| InChIKey | VWBRIPVVBLNQIR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.68 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |