C12H8ClF3N2O4S — CID 86582362
N-(5-chloro-3-hydroxy-2-pyridinyl)-3-(trifluoromethoxy)benzenesulfonamide (PubChem CID 86582362) has the molecular formula C12H8ClF3N2O4S and a molecular weight of 368.72 g/mol. Its IUPAC name is N-(5-chloro-3-hydroxy-2-pyridinyl)-3-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-(5-chloro-3-hydroxy-2-pyridinyl)-3-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 86582362 |
| Molecular Formula | C12H8ClF3N2O4S |
| Molecular Weight | 368.72 g/mol |
| Exact Mass | 367.98 |
| IUPAC Name | N-(5-chloro-3-hydroxy-2-pyridinyl)-3-(trifluoromethoxy)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ncc(Cl)cc1O)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C12H8ClF3N2O4S/c13-7-4-10(19)11(17-6-7)18-23(20,21)9-3-1-2-8(5-9)22-12(14,15)16/h1-6,19H,(H,17,18) |
| InChIKey | YATWWTFACOPYAD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.72 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |