C23H31Cl2N3O3 — CID 86581278
ethyl (4aS,5R,8aR)-4-[2-(3,4-dichlorophenyl)acetyl]-5-pyrrolidin-1-yl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate (PubChem CID 86581278) has the molecular formula C23H31Cl2N3O3 and a molecular weight of 468.43 g/mol. Its IUPAC name is ethyl (4aS,5R,8aR)-4-[2-(3,4-dichlorophenyl)acetyl]-5-pyrrolidin-1-yl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate.
| Compound Name | ethyl (4aS,5R,8aR)-4-[2-(3,4-dichlorophenyl)acetyl]-5-pyrrolidin-1-yl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
|---|---|
| PubChem CID | 86581278 |
| Molecular Formula | C23H31Cl2N3O3 |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | ethyl (4aS,5R,8aR)-4-[2-(3,4-dichlorophenyl)acetyl]-5-pyrrolidin-1-yl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)Cc2ccc(Cl)c(Cl)c2)[C@H]2[C@H](N3CCCC3)CCC[C@H]21 |
| InChI | InChI=1S/C23H31Cl2N3O3/c1-2-31-23(30)27-12-13-28(21(29)15-16-8-9-17(24)18(25)14-16)22-19(6-5-7-20(22)27)26-10-3-4-11-26/h8-9,14,19-20,22H,2-7,10-13,15H2,1H3/t19-,20-,22+/m1/s1 |
| InChIKey | QBPJJWQYSRZQSP-SJBKTWHCSA-N |
| XLogP | 4.22 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |