C24H35Cl2N3O — CID 86581568
1-[(4aR,8R,8aS)-4-butyl-8-pyrrolidin-1-yl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-2-(3,4-dichlorophenyl)ethanone (PubChem CID 86581568) has the molecular formula C24H35Cl2N3O and a molecular weight of 452.47 g/mol. Its IUPAC name is 1-[(4aR,8R,8aS)-4-butyl-8-pyrrolidin-1-yl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-2-(3,4-dichlorophenyl)ethanone.
| Compound Name | 1-[(4aR,8R,8aS)-4-butyl-8-pyrrolidin-1-yl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-2-(3,4-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 86581568 |
| Molecular Formula | C24H35Cl2N3O |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | 1-[(4aR,8R,8aS)-4-butyl-8-pyrrolidin-1-yl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-2-(3,4-dichlorophenyl)ethanone |
| SMILES | CCCCN1CCN(C(=O)Cc2ccc(Cl)c(Cl)c2)[C@H]2[C@H](N3CCCC3)CCC[C@H]21 |
| InChI | InChI=1S/C24H35Cl2N3O/c1-2-3-11-28-14-15-29(23(30)17-18-9-10-19(25)20(26)16-18)24-21(7-6-8-22(24)28)27-12-4-5-13-27/h9-10,16,21-22,24H,2-8,11-15,17H2,1H3/t21-,22-,24+/m1/s1 |
| InChIKey | QZYMRJVVDVLWFH-AKFKNWHVSA-N |
| XLogP | 4.87 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |