C24H31Cl2N3O4 — CID 68776205
4-[4-[2-(3,4-dichlorophenyl)acetyl]-5-pyrrolidin-1-yl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-4-oxobutanoic acid (PubChem CID 68776205) has the molecular formula C24H31Cl2N3O4 and a molecular weight of 496.44 g/mol. Its IUPAC name is 4-[4-[2-(3,4-dichlorophenyl)acetyl]-5-pyrrolidin-1-yl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-4-oxobutanoic acid.
| Compound Name | 4-[4-[2-(3,4-dichlorophenyl)acetyl]-5-pyrrolidin-1-yl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 68776205 |
| Molecular Formula | C24H31Cl2N3O4 |
| Molecular Weight | 496.44 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | 4-[4-[2-(3,4-dichlorophenyl)acetyl]-5-pyrrolidin-1-yl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)N1CCN(C(=O)Cc2ccc(Cl)c(Cl)c2)C2C(N3CCCC3)CCCC21 |
| InChI | InChI=1S/C24H31Cl2N3O4/c25-17-7-6-16(14-18(17)26)15-22(31)29-13-12-28(21(30)8-9-23(32)33)20-5-3-4-19(24(20)29)27-10-1-2-11-27/h6-7,14,19-20,24H,1-5,8-13,15H2,(H,32,33) |
| InChIKey | SBGQLPAJVNLQHT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |