C23H33ClN2O3 — CID 86611835
N-(1-adamantylmethyl)-2-chloro-3-[[2-(2-hydroxyethoxy)ethylamino]methyl]benzamide (PubChem CID 86611835) has the molecular formula C23H33ClN2O3 and a molecular weight of 420.98 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2-chloro-3-[[2-(2-hydroxyethoxy)ethylamino]methyl]benzamide.
| Compound Name | N-(1-adamantylmethyl)-2-chloro-3-[[2-(2-hydroxyethoxy)ethylamino]methyl]benzamide |
|---|---|
| PubChem CID | 86611835 |
| Molecular Formula | C23H33ClN2O3 |
| Molecular Weight | 420.98 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | N-(1-adamantylmethyl)-2-chloro-3-[[2-(2-hydroxyethoxy)ethylamino]methyl]benzamide |
| SMILES | O=C(NCC12CC3CC(CC(C3)C1)C2)c1cccc(CNCCOCCO)c1Cl |
| InChI | InChI=1S/C23H33ClN2O3/c24-21-19(14-25-4-6-29-7-5-27)2-1-3-20(21)22(28)26-15-23-11-16-8-17(12-23)10-18(9-16)13-23/h1-3,16-18,25,27H,4-15H2,(H,26,28) |
| InChIKey | PILIZVKHZDBFDV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.98 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|