C19H22BrCl2N3O — CID 86616408
4-benzyl-N-(3,5-dichlorophenyl)-4-methylpiperazin-4-ium-1-carboxamide bromide (PubChem CID 86616408) has the molecular formula C19H22BrCl2N3O and a molecular weight of 459.22 g/mol. Its IUPAC name is 4-benzyl-N-(3,5-dichlorophenyl)-4-methylpiperazin-4-ium-1-carboxamide bromide.
| Compound Name | 4-benzyl-N-(3,5-dichlorophenyl)-4-methylpiperazin-4-ium-1-carboxamide bromide |
|---|---|
| PubChem CID | 86616408 |
| Molecular Formula | C19H22BrCl2N3O |
| Molecular Weight | 459.22 g/mol |
| Exact Mass | 457.03 |
| IUPAC Name | 4-benzyl-N-(3,5-dichlorophenyl)-4-methylpiperazin-4-ium-1-carboxamide bromide |
| SMILES | C[N+]1(Cc2ccccc2)CCN(C(=O)Nc2cc(Cl)cc(Cl)c2)CC1.[Br-] |
| InChI | InChI=1S/C19H21Cl2N3O.BrH/c1-24(14-15-5-3-2-4-6-15)9-7-23(8-10-24)19(25)22-18-12-16(20)11-17(21)13-18;/h2-6,11-13H,7-10,14H2,1H3;1H |
| InChIKey | SWLCPHSMJYRJFC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|