C16H18F3N3O4 — CID 86634059
N-(1-ethyl-5,5-dimethyl-8-nitro-2-oxo-3,4-dihydro-1-benzazepin-3-yl)-2,2,2-trifluoroacetamide (PubChem CID 86634059) has the molecular formula C16H18F3N3O4 and a molecular weight of 373.33 g/mol. Its IUPAC name is N-(1-ethyl-5,5-dimethyl-8-nitro-2-oxo-3,4-dihydro-1-benzazepin-3-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(1-ethyl-5,5-dimethyl-8-nitro-2-oxo-3,4-dihydro-1-benzazepin-3-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 86634059 |
| Molecular Formula | C16H18F3N3O4 |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | N-(1-ethyl-5,5-dimethyl-8-nitro-2-oxo-3,4-dihydro-1-benzazepin-3-yl)-2,2,2-trifluoroacetamide |
| SMILES | CCN1C(=O)C(NC(=O)C(F)(F)F)CC(C)(C)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C16H18F3N3O4/c1-4-21-12-7-9(22(25)26)5-6-10(12)15(2,3)8-11(13(21)23)20-14(24)16(17,18)19/h5-7,11H,4,8H2,1-3H3,(H,20,24) |
| InChIKey | OYFNNSLGWURCNY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|