C30H23F5O5S2 — CID 86639514
2-(4-ethenylbenzoyl)oxy-1,1,3,3,3-pentafluoropropane-1-sulfonate;triphenylsulfanium (PubChem CID 86639514) has the molecular formula C30H23F5O5S2 and a molecular weight of 622.63 g/mol. Its IUPAC name is 2-(4-ethenylbenzoyl)oxy-1,1,3,3,3-pentafluoropropane-1-sulfonate;triphenylsulfanium.
| Compound Name | 2-(4-ethenylbenzoyl)oxy-1,1,3,3,3-pentafluoropropane-1-sulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 86639514 |
| Molecular Formula | C30H23F5O5S2 |
| Molecular Weight | 622.63 g/mol |
| Exact Mass | 622.09 |
| IUPAC Name | 2-(4-ethenylbenzoyl)oxy-1,1,3,3,3-pentafluoropropane-1-sulfonate;triphenylsulfanium |
| SMILES | C=Cc1ccc(C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)[O-])cc1.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C12H9F5O5S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-7-3-5-8(6-4-7)9(18)22-10(11(13,14)15)12(16,17)23(19,20)21/h1-15H;2-6,10H,1H2,(H,19,20,21)/q+1;/p-1 |
| InChIKey | CGCHDVYHWQYTKV-UHFFFAOYSA-M |
| XLogP | 7.34 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.63 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|