C12H13ClF3NO4S — CID 86653987
(7-chloro-2,2-dimethyl-4,5-dihydro-3H-1,4-benzoxazepin-5-yl) trifluoromethanesulfonate (PubChem CID 86653987) has the molecular formula C12H13ClF3NO4S and a molecular weight of 359.75 g/mol. Its IUPAC name is (7-chloro-2,2-dimethyl-4,5-dihydro-3H-1,4-benzoxazepin-5-yl) trifluoromethanesulfonate.
| Compound Name | (7-chloro-2,2-dimethyl-4,5-dihydro-3H-1,4-benzoxazepin-5-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86653987 |
| Molecular Formula | C12H13ClF3NO4S |
| Molecular Weight | 359.75 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | (7-chloro-2,2-dimethyl-4,5-dihydro-3H-1,4-benzoxazepin-5-yl) trifluoromethanesulfonate |
| SMILES | CC1(C)CNC(OS(=O)(=O)C(F)(F)F)c2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C12H13ClF3NO4S/c1-11(2)6-17-10(21-22(18,19)12(14,15)16)8-5-7(13)3-4-9(8)20-11/h3-5,10,17H,6H2,1-2H3 |
| InChIKey | PVCZRULIXYLPEA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.75 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|