C14H17F3O5S2 — CID 86671334
[4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexyl] methanesulfonate (PubChem CID 86671334) has the molecular formula C14H17F3O5S2 and a molecular weight of 386.41 g/mol. Its IUPAC name is [4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexyl] methanesulfonate.
| Compound Name | [4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexyl] methanesulfonate |
|---|---|
| PubChem CID | 86671334 |
| Molecular Formula | C14H17F3O5S2 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | [4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexyl] methanesulfonate |
| SMILES | CS(=O)(=O)OC1CCC(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C14H17F3O5S2/c1-23(18,19)22-11-5-7-12(8-6-11)24(20,21)13-4-2-3-10(9-13)14(15,16)17/h2-4,9,11-12H,5-8H2,1H3 |
| InChIKey | PKXBUWRRJWJECG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|