C26H27N7OS — CID 86675644
6-(5-isothiocyanato-2-methylphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]-7,8-dihydropyrido[4,3-d]pyrimidin-5-one (PubChem CID 86675644) has the molecular formula C26H27N7OS and a molecular weight of 485.62 g/mol. Its IUPAC name is 6-(5-isothiocyanato-2-methylphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]-7,8-dihydropyrido[4,3-d]pyrimidin-5-one.
| Compound Name | 6-(5-isothiocyanato-2-methylphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]-7,8-dihydropyrido[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 86675644 |
| Molecular Formula | C26H27N7OS |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 6-(5-isothiocyanato-2-methylphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]-7,8-dihydropyrido[4,3-d]pyrimidin-5-one |
| SMILES | Cc1ccc(N=C=S)cc1N1CCc2nc(Nc3ccc(N4CCN(C)CC4)cc3)ncc2C1=O |
| InChI | InChI=1S/C26H27N7OS/c1-18-3-4-20(28-17-35)15-24(18)33-10-9-23-22(25(33)34)16-27-26(30-23)29-19-5-7-21(8-6-19)32-13-11-31(2)12-14-32/h3-8,15-16H,9-14H2,1-2H3,(H,27,29,30) |
| InChIKey | FLTRZVLINCHYOT-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|