C33H38N2O11 — CID 86697600
[(2R,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-[3-[(E)-3-[3,5-bis(methylcarbamoyl)phenyl]prop-2-enyl]phenyl]oxan-2-yl]methyl acetate (PubChem CID 86697600) has the molecular formula C33H38N2O11 and a molecular weight of 638.67 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-[3-[(E)-3-[3,5-bis(methylcarbamoyl)phenyl]prop-2-enyl]phenyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-[3-[(E)-3-[3,5-bis(methylcarbamoyl)phenyl]prop-2-enyl]phenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 86697600 |
| Molecular Formula | C33H38N2O11 |
| Molecular Weight | 638.67 g/mol |
| Exact Mass | 638.25 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-[3-[(E)-3-[3,5-bis(methylcarbamoyl)phenyl]prop-2-enyl]phenyl]oxan-2-yl]methyl acetate |
| SMILES | CNC(=O)c1cc(/C=C/Cc2cccc([C@H]3O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]3OC(C)=O)c2)cc(C(=O)NC)c1 |
| InChI | InChI=1S/C33H38N2O11/c1-18(36)42-17-27-29(43-19(2)37)31(45-21(4)39)30(44-20(3)38)28(46-27)24-12-8-10-22(13-24)9-7-11-23-14-25(32(40)34-5)16-26(15-23)33(41)35-6/h7-8,10-16,27-31H,9,17H2,1-6H3,(H,34,40)(H,35,41)/b11-7+/t27-,28-,29-,30-,31+/m1/s1 |
| InChIKey | CSPPTBKCGZOGSD-UHMZLBFLSA-N |
| XLogP | 2.46 |
| TPSA | 172.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.67 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|