C20H21F3O12S — CID 89334125
[4,5-diacetyloxy-3-formyloxy-6-[3-(trifluoromethylsulfonyloxy)phenyl]oxan-2-yl]methyl acetate (PubChem CID 89334125) has the molecular formula C20H21F3O12S and a molecular weight of 542.44 g/mol. Its IUPAC name is [4,5-diacetyloxy-3-formyloxy-6-[3-(trifluoromethylsulfonyloxy)phenyl]oxan-2-yl]methyl acetate.
| Compound Name | [4,5-diacetyloxy-3-formyloxy-6-[3-(trifluoromethylsulfonyloxy)phenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 89334125 |
| Molecular Formula | C20H21F3O12S |
| Molecular Weight | 542.44 g/mol |
| Exact Mass | 542.07 |
| IUPAC Name | [4,5-diacetyloxy-3-formyloxy-6-[3-(trifluoromethylsulfonyloxy)phenyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(c2cccc(OS(=O)(=O)C(F)(F)F)c2)C(OC(C)=O)C(OC(C)=O)C1OC=O |
| InChI | InChI=1S/C20H21F3O12S/c1-10(25)30-8-15-17(31-9-24)19(33-12(3)27)18(32-11(2)26)16(34-15)13-5-4-6-14(7-13)35-36(28,29)20(21,22)23/h4-7,9,15-19H,8H2,1-3H3 |
| InChIKey | MPSIWDMKWFKWPR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.44 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|