C24H29BrF2N4O4Si — CID 86705682
3-bromo-11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-methyl-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one (PubChem CID 86705682) has the molecular formula C24H29BrF2N4O4Si and a molecular weight of 583.51 g/mol. Its IUPAC name is 3-bromo-11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-methyl-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one.
| Compound Name | 3-bromo-11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-methyl-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one |
|---|---|
| PubChem CID | 86705682 |
| Molecular Formula | C24H29BrF2N4O4Si |
| Molecular Weight | 583.51 g/mol |
| Exact Mass | 582.11 |
| IUPAC Name | 3-bromo-11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-methyl-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one |
| SMILES | COc1cc(OC)c(F)c(N2Cc3cnc4c(c(Br)cn4COCC[Si](C)(C)C)c3N(C)C2=O)c1F |
| InChI | InChI=1S/C24H29BrF2N4O4Si/c1-29-21-14(10-28-23-18(21)15(25)12-30(23)13-35-7-8-36(4,5)6)11-31(24(29)32)22-19(26)16(33-2)9-17(34-3)20(22)27/h9-10,12H,7-8,11,13H2,1-6H3 |
| InChIKey | HTNWJPPGKNKDFY-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 69.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.51 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|