About isobutane hydroperoxide
isobutane hydroperoxide (PubChem CID 86736568) has the molecular formula C4H11O2-
and a molecular weight of 91.13 g/mol.
Molecular Properties
| Compound Name | isobutane hydroperoxide |
| PubChem CID | 86736568 |
| Molecular Formula | C4H11O2- |
| Molecular Weight | 91.13 g/mol |
| Exact Mass | 91.08 |
| IUPAC Name | — |
| SMILES | CC(C)C.[O-]O |
| InChI | InChI=1S/C4H10.H2O2/c1-4(2)3;1-2/h4H,1-3H3;1-2H/p-1 |
| InChIKey | OYMKLTPMFOCLTL-UHFFFAOYSA-M |
| XLogP | 0.48 |
| TPSA | 43.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 91.13 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze isobutane hydroperoxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isobutane hydroperoxide?
The IUPAC name of isobutane hydroperoxide (CID 86736568) is not available.
What is the SMILES notation for isobutane hydroperoxide?
The canonical SMILES for isobutane hydroperoxide is CC(C)C.[O-]O.
What is the InChIKey of isobutane hydroperoxide?
The InChIKey is OYMKLTPMFOCLTL-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H10.H2O2/c1-4(2)3;1-2/h4H,1-3H3;1-2H/p-1.
What are the key properties of isobutane hydroperoxide?
isobutane hydroperoxide has a molecular weight of 91.13 g/mol, XLogP of 0.48, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for isobutane hydroperoxide is sourced from PubChem (CID 86736568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).