C22H25F2N3O3 — CID 86880071
1-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-3-[2-(6-methyl-1H-indol-3-yl)ethyl]urea (PubChem CID 86880071) has the molecular formula C22H25F2N3O3 and a molecular weight of 417.46 g/mol. Its IUPAC name is 1-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-3-[2-(6-methyl-1H-indol-3-yl)ethyl]urea.
| Compound Name | 1-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-3-[2-(6-methyl-1H-indol-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 86880071 |
| Molecular Formula | C22H25F2N3O3 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 1-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-3-[2-(6-methyl-1H-indol-3-yl)ethyl]urea |
| SMILES | COc1ccc(CCNC(=O)NCCc2c[nH]c3cc(C)ccc23)cc1OC(F)F |
| InChI | InChI=1S/C22H25F2N3O3/c1-14-3-5-17-16(13-27-18(17)11-14)8-10-26-22(28)25-9-7-15-4-6-19(29-2)20(12-15)30-21(23)24/h3-6,11-13,21,27H,7-10H2,1-2H3,(H2,25,26,28) |
| InChIKey | UARPKGLSKWFDDE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |