C17H18F2N2O3S2 — CID 86889729
N'-[4-(difluoromethylsulfonyl)phenyl]-4-phenylsulfanylbutanehydrazide (PubChem CID 86889729) has the molecular formula C17H18F2N2O3S2 and a molecular weight of 400.47 g/mol. Its IUPAC name is N'-[4-(difluoromethylsulfonyl)phenyl]-4-phenylsulfanylbutanehydrazide.
| Compound Name | N'-[4-(difluoromethylsulfonyl)phenyl]-4-phenylsulfanylbutanehydrazide |
|---|---|
| PubChem CID | 86889729 |
| Molecular Formula | C17H18F2N2O3S2 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | N'-[4-(difluoromethylsulfonyl)phenyl]-4-phenylsulfanylbutanehydrazide |
| SMILES | O=C(CCCSc1ccccc1)NNc1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C17H18F2N2O3S2/c18-17(19)26(23,24)15-10-8-13(9-11-15)20-21-16(22)7-4-12-25-14-5-2-1-3-6-14/h1-3,5-6,8-11,17,20H,4,7,12H2,(H,21,22) |
| InChIKey | ALJGDJFVLUBNEO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|