C21H19Cl2N5O — CID 87057384
(2,4-dichlorophenyl)-[5-(6-methyl-2-pyridinyl)-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone (PubChem CID 87057384) has the molecular formula C21H19Cl2N5O and a molecular weight of 428.32 g/mol. Its IUPAC name is (2,4-dichlorophenyl)-[5-(6-methyl-2-pyridinyl)-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone.
| Compound Name | (2,4-dichlorophenyl)-[5-(6-methyl-2-pyridinyl)-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone |
|---|---|
| PubChem CID | 87057384 |
| Molecular Formula | C21H19Cl2N5O |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | (2,4-dichlorophenyl)-[5-(6-methyl-2-pyridinyl)-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone |
| SMILES | Cc1cccc(-c2nnc3n2CC2CCCC3N2C(=O)c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C21H19Cl2N5O/c1-12-4-2-6-17(24-12)19-25-26-20-18-7-3-5-14(11-27(19)20)28(18)21(29)15-9-8-13(22)10-16(15)23/h2,4,6,8-10,14,18H,3,5,7,11H2,1H3 |
| InChIKey | FPZJFCLMBUWBSJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |