C22H19NO4 — CID 87106577
4-[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenoxy]benzaldehyde (PubChem CID 87106577) has the molecular formula C22H19NO4 and a molecular weight of 361.40 g/mol. Its IUPAC name is 4-[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenoxy]benzaldehyde.
| Compound Name | 4-[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenoxy]benzaldehyde |
|---|---|
| PubChem CID | 87106577 |
| Molecular Formula | C22H19NO4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 4-[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenoxy]benzaldehyde |
| SMILES | CO/N=C(\COc1ccc(Oc2ccc(C=O)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H19NO4/c1-25-23-22(18-5-3-2-4-6-18)16-26-19-11-13-21(14-12-19)27-20-9-7-17(15-24)8-10-20/h2-15H,16H2,1H3/b23-22+ |
| InChIKey | ZSMFGDZMAHTHFB-GHVJWSGMSA-N |
| XLogP | 4.72 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|