C27H38Si3 — CID 87109962
[1-cyclopenta-1,3-dien-1-yl-2,5-bis(trimethylsilyl)-9H-fluoren-3-yl]-trimethylsilane (PubChem CID 87109962) has the molecular formula C27H38Si3 and a molecular weight of 446.86 g/mol. Its IUPAC name is [1-cyclopenta-1,3-dien-1-yl-2,5-bis(trimethylsilyl)-9H-fluoren-3-yl]-trimethylsilane.
| Compound Name | [1-cyclopenta-1,3-dien-1-yl-2,5-bis(trimethylsilyl)-9H-fluoren-3-yl]-trimethylsilane |
|---|---|
| PubChem CID | 87109962 |
| Molecular Formula | C27H38Si3 |
| Molecular Weight | 446.86 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | [1-cyclopenta-1,3-dien-1-yl-2,5-bis(trimethylsilyl)-9H-fluoren-3-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1cccc2c1-c1cc([Si](C)(C)C)c([Si](C)(C)C)c(C3=CC=CC3)c1C2 |
| InChI | InChI=1S/C27H38Si3/c1-28(2,3)23-16-12-15-20-17-21-22(25(20)23)18-24(29(4,5)6)27(30(7,8)9)26(21)19-13-10-11-14-19/h10-13,15-16,18H,14,17H2,1-9H3 |
| InChIKey | RNBYZYFTXCESNR-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.86 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|