C18H23N2O7PS — CID 87126889
5-[benzenesulfonyl(phenoxy)amino]pentylcarbamoylphosphonic acid (PubChem CID 87126889) has the molecular formula C18H23N2O7PS and a molecular weight of 442.43 g/mol. Its IUPAC name is 5-[benzenesulfonyl(phenoxy)amino]pentylcarbamoylphosphonic acid.
| Compound Name | 5-[benzenesulfonyl(phenoxy)amino]pentylcarbamoylphosphonic acid |
|---|---|
| PubChem CID | 87126889 |
| Molecular Formula | C18H23N2O7PS |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 5-[benzenesulfonyl(phenoxy)amino]pentylcarbamoylphosphonic acid |
| SMILES | O=C(NCCCCCN(Oc1ccccc1)S(=O)(=O)c1ccccc1)P(=O)(O)O |
| InChI | InChI=1S/C18H23N2O7PS/c21-18(28(22,23)24)19-14-8-3-9-15-20(27-16-10-4-1-5-11-16)29(25,26)17-12-6-2-7-13-17/h1-2,4-7,10-13H,3,8-9,14-15H2,(H,19,21)(H2,22,23,24) |
| InChIKey | RQDFWRLZTAAPLW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|