C12H24F6O8S2 — CID 87127926
butane-1,2-diol;bis(1,1,1-trifluoro-2-methylpropane-2-sulfonic acid) (PubChem CID 87127926) has the molecular formula C12H24F6O8S2 and a molecular weight of 474.44 g/mol. Its IUPAC name is butane-1,2-diol;bis(1,1,1-trifluoro-2-methylpropane-2-sulfonic acid).
| Compound Name | butane-1,2-diol;bis(1,1,1-trifluoro-2-methylpropane-2-sulfonic acid) |
|---|---|
| PubChem CID | 87127926 |
| Molecular Formula | C12H24F6O8S2 |
| Molecular Weight | 474.44 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | butane-1,2-diol;bis(1,1,1-trifluoro-2-methylpropane-2-sulfonic acid) |
| SMILES | CC(C)(C(F)(F)F)S(=O)(=O)O.CC(C)(C(F)(F)F)S(=O)(=O)O.CCC(O)CO |
| InChI | InChI=1S/2C4H7F3O3S.C4H10O2/c2*1-3(2,4(5,6)7)11(8,9)10;1-2-4(6)3-5/h2*1-2H3,(H,8,9,10);4-6H,2-3H2,1H3 |
| InChIKey | QHYYHYLONMTRBS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.44 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|