C12H21FNO3P — CID 87153852
3-[[(2R,3R,4S,5R,6S)-2-(deuteriomethyl)-4-fluoro-5,6-dimethyloxan-3-yl]oxy-methylphosphanyl]oxypropanenitrile (PubChem CID 87153852) has the molecular formula C12H21FNO3P and a molecular weight of 278.28 g/mol. Its IUPAC name is 3-[[(2R,3R,4S,5R,6S)-2-(deuteriomethyl)-4-fluoro-5,6-dimethyloxan-3-yl]oxy-methylphosphanyl]oxypropanenitrile.
| Compound Name | 3-[[(2R,3R,4S,5R,6S)-2-(deuteriomethyl)-4-fluoro-5,6-dimethyloxan-3-yl]oxy-methylphosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 87153852 |
| Molecular Formula | C12H21FNO3P |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 3-[[(2R,3R,4S,5R,6S)-2-(deuteriomethyl)-4-fluoro-5,6-dimethyloxan-3-yl]oxy-methylphosphanyl]oxypropanenitrile |
| SMILES | [2H]C[C@H]1O[C@@H](C)[C@@H](C)[C@H](F)[C@@H]1OP(C)OCCC#N |
| InChI | InChI=1S/C12H21FNO3P/c1-8-9(2)16-10(3)12(11(8)13)17-18(4)15-7-5-6-14/h8-12H,5,7H2,1-4H3/t8-,9+,10-,11+,12-,18?/m1/s1/i3D |
| InChIKey | YEHJYQWWODXPBX-JIOLWICUSA-N |
| XLogP | 3.02 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|