C8H8N2O4 — CID 87158716
[(3S,3aR,6R,6aS)-3-isocyanato-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] cyanate (PubChem CID 87158716) has the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. Its IUPAC name is [(3S,3aR,6R,6aS)-3-isocyanato-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] cyanate.
| Compound Name | [(3S,3aR,6R,6aS)-3-isocyanato-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] cyanate |
|---|---|
| PubChem CID | 87158716 |
| Molecular Formula | C8H8N2O4 |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | [(3S,3aR,6R,6aS)-3-isocyanato-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] cyanate |
| SMILES | N#CO[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2N=C=O |
| InChI | InChI=1S/C8H8N2O4/c9-3-14-6-2-13-7-5(10-4-11)1-12-8(6)7/h5-8H,1-2H2/t5-,6+,7+,8+/m0/s1 |
| InChIKey | MRTNDMBPUWXJJT-LXGUWJNJSA-N |
| XLogP | -0.65 |
| TPSA | 80.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|