C18H24O3 — CID 87173787
2-methyl-4-[5-(oxiran-2-ylmethoxymethyl)-2-bicyclo[2.2.1]heptanyl]phenol (PubChem CID 87173787) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-methyl-4-[5-(oxiran-2-ylmethoxymethyl)-2-bicyclo[2.2.1]heptanyl]phenol.
| Compound Name | 2-methyl-4-[5-(oxiran-2-ylmethoxymethyl)-2-bicyclo[2.2.1]heptanyl]phenol |
|---|---|
| PubChem CID | 87173787 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 2-methyl-4-[5-(oxiran-2-ylmethoxymethyl)-2-bicyclo[2.2.1]heptanyl]phenol |
| SMILES | Cc1cc(C2CC3CC2CC3COCC2CO2)ccc1O |
| InChI | InChI=1S/C18H24O3/c1-11-4-12(2-3-18(11)19)17-7-13-5-14(17)6-15(13)8-20-9-16-10-21-16/h2-4,13-17,19H,5-10H2,1H3 |
| InChIKey | YXQOVXBNIIVCFW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|