C8H20N2O10 — CID 87192699
bis(methyl(2,2,2-trihydroxyethyl)azanium);oxalate (PubChem CID 87192699) has the molecular formula C8H20N2O10 and a molecular weight of 304.25 g/mol. Its IUPAC name is bis(methyl(2,2,2-trihydroxyethyl)azanium);oxalate.
| Compound Name | bis(methyl(2,2,2-trihydroxyethyl)azanium);oxalate |
|---|---|
| PubChem CID | 87192699 |
| Molecular Formula | C8H20N2O10 |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | bis(methyl(2,2,2-trihydroxyethyl)azanium);oxalate |
| SMILES | C[NH2+]CC(O)(O)O.C[NH2+]CC(O)(O)O.O=C([O-])C(=O)[O-] |
| InChI | InChI=1S/2C3H9NO3.C2H2O4/c2*1-4-2-3(5,6)7;3-1(4)2(5)6/h2*4-7H,2H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | NDOOAVXUDBLPCA-UHFFFAOYSA-N |
| XLogP | -9.89 |
| TPSA | 234.86 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | -9.89 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|