C13H12F2O6 — CID 87274077
methyl 3-(3,5-difluoro-4-formylphenoxy)carbonyloxybutanoate (PubChem CID 87274077) has the molecular formula C13H12F2O6 and a molecular weight of 302.23 g/mol. Its IUPAC name is methyl 3-(3,5-difluoro-4-formylphenoxy)carbonyloxybutanoate.
| Compound Name | methyl 3-(3,5-difluoro-4-formylphenoxy)carbonyloxybutanoate |
|---|---|
| PubChem CID | 87274077 |
| Molecular Formula | C13H12F2O6 |
| Molecular Weight | 302.23 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | methyl 3-(3,5-difluoro-4-formylphenoxy)carbonyloxybutanoate |
| SMILES | COC(=O)CC(C)OC(=O)Oc1cc(F)c(C=O)c(F)c1 |
| InChI | InChI=1S/C13H12F2O6/c1-7(3-12(17)19-2)20-13(18)21-8-4-10(14)9(6-16)11(15)5-8/h4-7H,3H2,1-2H3 |
| InChIKey | FDGNLKDXPGQNKZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.23 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|