C15H25NO3S — CID 87288219
(2R)-2-[[(4E)-5,9-dimethyl-2-oxodeca-4,8-dien-3-yl]amino]-3-sulfanylpropanoic acid (PubChem CID 87288219) has the molecular formula C15H25NO3S and a molecular weight of 299.44 g/mol. Its IUPAC name is (2R)-2-[[(4E)-5,9-dimethyl-2-oxodeca-4,8-dien-3-yl]amino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[[(4E)-5,9-dimethyl-2-oxodeca-4,8-dien-3-yl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 87288219 |
| Molecular Formula | C15H25NO3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | (2R)-2-[[(4E)-5,9-dimethyl-2-oxodeca-4,8-dien-3-yl]amino]-3-sulfanylpropanoic acid |
| SMILES | CC(=O)C(/C=C(\C)CCC=C(C)C)N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C15H25NO3S/c1-10(2)6-5-7-11(3)8-13(12(4)17)16-14(9-20)15(18)19/h6,8,13-14,16,20H,5,7,9H2,1-4H3,(H,18,19)/b11-8+/t13?,14-/m0/s1 |
| InChIKey | YEPYOKAAIOJOCC-NXWXSEJGSA-N |
| XLogP | 2.61 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|