C25H41NO3S — CID 87586752
2-[[(2E)-3,7-dimethylocta-2,6-dienyl]-[(4E)-5,9-dimethyl-2-oxodeca-4,8-dien-3-yl]amino]-3-sulfanylpropanoic acid (PubChem CID 87586752) has the molecular formula C25H41NO3S and a molecular weight of 435.67 g/mol. Its IUPAC name is 2-[[(2E)-3,7-dimethylocta-2,6-dienyl]-[(4E)-5,9-dimethyl-2-oxodeca-4,8-dien-3-yl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[(2E)-3,7-dimethylocta-2,6-dienyl]-[(4E)-5,9-dimethyl-2-oxodeca-4,8-dien-3-yl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 87586752 |
| Molecular Formula | C25H41NO3S |
| Molecular Weight | 435.67 g/mol |
| Exact Mass | 435.28 |
| IUPAC Name | 2-[[(2E)-3,7-dimethylocta-2,6-dienyl]-[(4E)-5,9-dimethyl-2-oxodeca-4,8-dien-3-yl]amino]-3-sulfanylpropanoic acid |
| SMILES | CC(=O)C(/C=C(\C)CCC=C(C)C)N(C/C=C(\C)CCC=C(C)C)C(CS)C(=O)O |
| InChI | InChI=1S/C25H41NO3S/c1-18(2)10-8-12-20(5)14-15-26(24(17-30)25(28)29)23(22(7)27)16-21(6)13-9-11-19(3)4/h10-11,14,16,23-24,30H,8-9,12-13,15,17H2,1-7H3,(H,28,29)/b20-14+,21-16+ |
| InChIKey | XVYVFZOHYFOKHF-QUFKBVBHSA-N |
| XLogP | 6.01 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.67 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|