C21H36N2O2S — CID 87323342
(2R)-2-[acetyl(3,7,11-trimethyldodeca-2,6,10-trien-5-yl)amino]-N-methyl-3-sulfanylpropanamide (PubChem CID 87323342) has the molecular formula C21H36N2O2S and a molecular weight of 380.60 g/mol. Its IUPAC name is (2R)-2-[acetyl(3,7,11-trimethyldodeca-2,6,10-trien-5-yl)amino]-N-methyl-3-sulfanylpropanamide.
| Compound Name | (2R)-2-[acetyl(3,7,11-trimethyldodeca-2,6,10-trien-5-yl)amino]-N-methyl-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 87323342 |
| Molecular Formula | C21H36N2O2S |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | (2R)-2-[acetyl(3,7,11-trimethyldodeca-2,6,10-trien-5-yl)amino]-N-methyl-3-sulfanylpropanamide |
| SMILES | CC=C(C)CC(C=C(C)CCC=C(C)C)N(C(C)=O)[C@@H](CS)C(=O)NC |
| InChI | InChI=1S/C21H36N2O2S/c1-8-16(4)12-19(13-17(5)11-9-10-15(2)3)23(18(6)24)20(14-26)21(25)22-7/h8,10,13,19-20,26H,9,11-12,14H2,1-7H3,(H,22,25)/t19?,20-/m0/s1 |
| InChIKey | ZTORGECPOUJPPF-ANYOKISRSA-N |
| XLogP | 4.30 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|