C25H41NO3S — CID 91054428
(2R)-2-[acetyl-[3,8,12-trimethyl-5-(2-methylprop-1-enyl)trideca-2,7,11-trienyl]amino]-3-sulfanylpropanoic acid (PubChem CID 91054428) has the molecular formula C25H41NO3S and a molecular weight of 435.67 g/mol. Its IUPAC name is (2R)-2-[acetyl-[3,8,12-trimethyl-5-(2-methylprop-1-enyl)trideca-2,7,11-trienyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[acetyl-[3,8,12-trimethyl-5-(2-methylprop-1-enyl)trideca-2,7,11-trienyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 91054428 |
| Molecular Formula | C25H41NO3S |
| Molecular Weight | 435.67 g/mol |
| Exact Mass | 435.28 |
| IUPAC Name | (2R)-2-[acetyl-[3,8,12-trimethyl-5-(2-methylprop-1-enyl)trideca-2,7,11-trienyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CC(=O)N(CC=C(C)CC(C=C(C)C)CC=C(C)CCC=C(C)C)[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C25H41NO3S/c1-18(2)9-8-10-20(5)11-12-23(15-19(3)4)16-21(6)13-14-26(22(7)27)24(17-30)25(28)29/h9,11,13,15,23-24,30H,8,10,12,14,16-17H2,1-7H3,(H,28,29)/t23?,24-/m0/s1 |
| InChIKey | RONIQGFNTNVKIT-CGAIIQECSA-N |
| XLogP | 6.22 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.67 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|