C15HF25O2 — CID 87306464
1,1,2,3,3,4,4,4-octafluoro-1-[[1,3,4,4,5,6,6,7,8,8,9,9,10,10-tetradecafluoro-2-(trifluoromethyl)-2-adamantyl]oxy]butan-2-ol (PubChem CID 87306464) has the molecular formula C15HF25O2 and a molecular weight of 688.12 g/mol. Its IUPAC name is 1,1,2,3,3,4,4,4-octafluoro-1-[[1,3,4,4,5,6,6,7,8,8,9,9,10,10-tetradecafluoro-2-(trifluoromethyl)-2-adamantyl]oxy]butan-2-ol.
| Compound Name | 1,1,2,3,3,4,4,4-octafluoro-1-[[1,3,4,4,5,6,6,7,8,8,9,9,10,10-tetradecafluoro-2-(trifluoromethyl)-2-adamantyl]oxy]butan-2-ol |
|---|---|
| PubChem CID | 87306464 |
| Molecular Formula | C15HF25O2 |
| Molecular Weight | 688.12 g/mol |
| Exact Mass | 687.96 |
| IUPAC Name | 1,1,2,3,3,4,4,4-octafluoro-1-[[1,3,4,4,5,6,6,7,8,8,9,9,10,10-tetradecafluoro-2-(trifluoromethyl)-2-adamantyl]oxy]butan-2-ol |
| SMILES | OC(F)(C(F)(F)OC1(C(F)(F)F)C2(F)C(F)(F)C3(F)C(F)(F)C(F)(C2(F)F)C(F)(F)C1(F)C3(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15HF25O2/c16-1-5(13(33,34)35,42-15(39,40)12(32,41)11(30,31)14(36,37)38)2(17)8(24,25)3(18,6(1,20)21)10(28,29)4(19,7(1,22)23)9(2,26)27/h41H |
| InChIKey | PJKABKYYPRJSED-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.12 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|