C16HF27O2 — CID 87307670
1,1,2,3,3,4,4,5,5,5-decafluoro-1-[[1,3,4,4,5,6,6,7,8,8,9,9,10,10-tetradecafluoro-2-(trifluoromethyl)-2-adamantyl]oxy]pentan-2-ol (PubChem CID 87307670) has the molecular formula C16HF27O2 and a molecular weight of 738.13 g/mol. Its IUPAC name is 1,1,2,3,3,4,4,5,5,5-decafluoro-1-[[1,3,4,4,5,6,6,7,8,8,9,9,10,10-tetradecafluoro-2-(trifluoromethyl)-2-adamantyl]oxy]pentan-2-ol.
| Compound Name | 1,1,2,3,3,4,4,5,5,5-decafluoro-1-[[1,3,4,4,5,6,6,7,8,8,9,9,10,10-tetradecafluoro-2-(trifluoromethyl)-2-adamantyl]oxy]pentan-2-ol |
|---|---|
| PubChem CID | 87307670 |
| Molecular Formula | C16HF27O2 |
| Molecular Weight | 738.13 g/mol |
| Exact Mass | 737.95 |
| IUPAC Name | 1,1,2,3,3,4,4,5,5,5-decafluoro-1-[[1,3,4,4,5,6,6,7,8,8,9,9,10,10-tetradecafluoro-2-(trifluoromethyl)-2-adamantyl]oxy]pentan-2-ol |
| SMILES | OC(F)(C(F)(F)OC1(C(F)(F)F)C2(F)C(F)(F)C3(F)C(F)(F)C(F)(C2(F)F)C(F)(F)C1(F)C3(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16HF27O2/c17-1-5(14(36,37)38,45-16(42,43)13(35,44)11(31,32)12(33,34)15(39,40)41)2(18)8(25,26)3(19,6(1,21)22)10(29,30)4(20,7(1,23)24)9(2,27)28/h44H |
| InChIKey | WVOSSCYZBKIAAE-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.13 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|