C17H20F3N3O2 — CID 87319471
N-[5-(2-aminophenyl)pent-4-ynyl]-2-[(2,2,2-trifluoroacetyl)amino]butanamide (PubChem CID 87319471) has the molecular formula C17H20F3N3O2 and a molecular weight of 355.36 g/mol. Its IUPAC name is N-[5-(2-aminophenyl)pent-4-ynyl]-2-[(2,2,2-trifluoroacetyl)amino]butanamide.
| Compound Name | N-[5-(2-aminophenyl)pent-4-ynyl]-2-[(2,2,2-trifluoroacetyl)amino]butanamide |
|---|---|
| PubChem CID | 87319471 |
| Molecular Formula | C17H20F3N3O2 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N-[5-(2-aminophenyl)pent-4-ynyl]-2-[(2,2,2-trifluoroacetyl)amino]butanamide |
| SMILES | CCC(NC(=O)C(F)(F)F)C(=O)NCCCC#Cc1ccccc1N |
| InChI | InChI=1S/C17H20F3N3O2/c1-2-14(23-16(25)17(18,19)20)15(24)22-11-7-3-4-8-12-9-5-6-10-13(12)21/h5-6,9-10,14H,2-3,7,11,21H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | XLDJIHHLMWWPJF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|