C22H22N6O6S — CID 87366317
1-[(6-aminopurin-9-yl)methoxy]ethyl N-(2-phenylmethoxybenzoyl)sulfamate (PubChem CID 87366317) has the molecular formula C22H22N6O6S and a molecular weight of 498.52 g/mol. Its IUPAC name is 1-[(6-aminopurin-9-yl)methoxy]ethyl N-(2-phenylmethoxybenzoyl)sulfamate.
| Compound Name | 1-[(6-aminopurin-9-yl)methoxy]ethyl N-(2-phenylmethoxybenzoyl)sulfamate |
|---|---|
| PubChem CID | 87366317 |
| Molecular Formula | C22H22N6O6S |
| Molecular Weight | 498.52 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | 1-[(6-aminopurin-9-yl)methoxy]ethyl N-(2-phenylmethoxybenzoyl)sulfamate |
| SMILES | CC(OCn1cnc2c(N)ncnc21)OS(=O)(=O)NC(=O)c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C22H22N6O6S/c1-15(33-14-28-13-26-19-20(23)24-12-25-21(19)28)34-35(30,31)27-22(29)17-9-5-6-10-18(17)32-11-16-7-3-2-4-8-16/h2-10,12-13,15H,11,14H2,1H3,(H,27,29)(H2,23,24,25) |
| InChIKey | LHEZARLYUFCABD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 160.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.52 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|