About dipotassium;2-sulfidopropanoate
dipotassium;2-sulfidopropanoate (PubChem CID 87368929) has the molecular formula C3H4K2O2S
and a molecular weight of 182.33 g/mol. Its IUPAC name is dipotassium;2-sulfidopropanoate.
Molecular Properties
| Compound Name | dipotassium;2-sulfidopropanoate |
| PubChem CID | 87368929 |
| Molecular Formula | C3H4K2O2S |
| Molecular Weight | 182.33 g/mol |
| Exact Mass | 181.92 |
| IUPAC Name | dipotassium;2-sulfidopropanoate |
| SMILES | CC([S-])C(=O)[O-].[K+].[K+] |
| InChI | InChI=1S/C3H6O2S.2K/c1-2(6)3(4)5;;/h2,6H,1H3,(H,4,5);;/q;2*+1/p-2 |
| InChIKey | MUQOWYWUUVFUFV-UHFFFAOYSA-L |
| XLogP | -7.32 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.33 |
| LogP ≤ 5 | -7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;2-sulfidopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;2-sulfidopropanoate?
The IUPAC name of dipotassium;2-sulfidopropanoate (CID 87368929) is dipotassium;2-sulfidopropanoate.
What is the SMILES notation for dipotassium;2-sulfidopropanoate?
The canonical SMILES for dipotassium;2-sulfidopropanoate is CC([S-])C(=O)[O-].[K+].[K+].
What is the InChIKey of dipotassium;2-sulfidopropanoate?
The InChIKey is MUQOWYWUUVFUFV-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H6O2S.2K/c1-2(6)3(4)5;;/h2,6H,1H3,(H,4,5);;/q;2*+1/p-2.
What are the key properties of dipotassium;2-sulfidopropanoate?
dipotassium;2-sulfidopropanoate has a molecular weight of 182.33 g/mol, XLogP of -7.32, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;2-sulfidopropanoate is sourced from PubChem (CID 87368929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).