C19H21N2O4PS2 — CID 87400334
propan-2-yl 2-[[phenoxy-(2-sulfanylidene-1,3-benzothiazol-3-yl)phosphoryl]amino]propanoate (PubChem CID 87400334) has the molecular formula C19H21N2O4PS2 and a molecular weight of 436.50 g/mol. Its IUPAC name is propan-2-yl 2-[[phenoxy-(2-sulfanylidene-1,3-benzothiazol-3-yl)phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[phenoxy-(2-sulfanylidene-1,3-benzothiazol-3-yl)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 87400334 |
| Molecular Formula | C19H21N2O4PS2 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | propan-2-yl 2-[[phenoxy-(2-sulfanylidene-1,3-benzothiazol-3-yl)phosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)C(C)NP(=O)(Oc1ccccc1)n1c(=S)sc2ccccc21 |
| InChI | InChI=1S/C19H21N2O4PS2/c1-13(2)24-18(22)14(3)20-26(23,25-15-9-5-4-6-10-15)21-16-11-7-8-12-17(16)28-19(21)27/h4-14H,1-3H3,(H,20,23) |
| InChIKey | LQZGBJAKNRYLKW-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|