C28H30ClN3O6 — CID 87416915
ethyl 2-[[4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalen-1-yl]-methoxycarbonylamino]-4-methylpentanoate (PubChem CID 87416915) has the molecular formula C28H30ClN3O6 and a molecular weight of 540.02 g/mol. Its IUPAC name is ethyl 2-[[4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalen-1-yl]-methoxycarbonylamino]-4-methylpentanoate.
| Compound Name | ethyl 2-[[4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalen-1-yl]-methoxycarbonylamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 87416915 |
| Molecular Formula | C28H30ClN3O6 |
| Molecular Weight | 540.02 g/mol |
| Exact Mass | 539.18 |
| IUPAC Name | ethyl 2-[[4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalen-1-yl]-methoxycarbonylamino]-4-methylpentanoate |
| SMILES | CCOC(=O)C(CC(C)C)N(C(=O)OC)c1ccc(/C=N/NC(=O)c2ccc(O)c(Cl)c2)c2ccccc12 |
| InChI | InChI=1S/C28H30ClN3O6/c1-5-38-27(35)24(14-17(2)3)32(28(36)37-4)23-12-10-19(20-8-6-7-9-21(20)23)16-30-31-26(34)18-11-13-25(33)22(29)15-18/h6-13,15-17,24,33H,5,14H2,1-4H3,(H,31,34)/b30-16+ |
| InChIKey | NTSDXSKZGAHRDV-OKCVXOCRSA-N |
| XLogP | 5.51 |
| TPSA | 117.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.02 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|