C7H7F6NO — CID 87441607
N-(1,1,2,3,3,3-hexafluoropropyl)-2-methylprop-2-enamide (PubChem CID 87441607) has the molecular formula C7H7F6NO and a molecular weight of 235.13 g/mol. Its IUPAC name is N-(1,1,2,3,3,3-hexafluoropropyl)-2-methylprop-2-enamide.
| Compound Name | N-(1,1,2,3,3,3-hexafluoropropyl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 87441607 |
| Molecular Formula | C7H7F6NO |
| Molecular Weight | 235.13 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | N-(1,1,2,3,3,3-hexafluoropropyl)-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C7H7F6NO/c1-3(2)4(15)14-7(12,13)5(8)6(9,10)11/h5H,1H2,2H3,(H,14,15) |
| InChIKey | NBGKBLUHTBJSFM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.13 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|