C20H19N3O3S2 — CID 87453207
(5Z)-3-cyclohexyl-5-[[3-(3-nitrophenyl)thiophen-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 87453207) has the molecular formula C20H19N3O3S2 and a molecular weight of 413.52 g/mol. Its IUPAC name is (5Z)-3-cyclohexyl-5-[[3-(3-nitrophenyl)thiophen-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-3-cyclohexyl-5-[[3-(3-nitrophenyl)thiophen-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 87453207 |
| Molecular Formula | C20H19N3O3S2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | (5Z)-3-cyclohexyl-5-[[3-(3-nitrophenyl)thiophen-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C1/C(=C/c2sccc2-c2cccc([N+](=O)[O-])c2)NC(=S)N1C1CCCCC1 |
| InChI | InChI=1S/C20H19N3O3S2/c24-19-17(21-20(27)22(19)14-6-2-1-3-7-14)12-18-16(9-10-28-18)13-5-4-8-15(11-13)23(25)26/h4-5,8-12,14H,1-3,6-7H2,(H,21,27)/b17-12- |
| InChIKey | BKTBHZCKNXPDBY-ATVHPVEESA-N |
| XLogP | 4.71 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|