C34H36N2S6Zn — CID 87462558
zinc bis([bis(2,3-dimethylphenyl)-sulfidoazaniumyl]methanedithioate) (PubChem CID 87462558) has the molecular formula C34H36N2S6Zn and a molecular weight of 730.47 g/mol. Its IUPAC name is zinc bis([bis(2,3-dimethylphenyl)-sulfidoazaniumyl]methanedithioate).
| Compound Name | zinc bis([bis(2,3-dimethylphenyl)-sulfidoazaniumyl]methanedithioate) |
|---|---|
| PubChem CID | 87462558 |
| Molecular Formula | C34H36N2S6Zn |
| Molecular Weight | 730.47 g/mol |
| Exact Mass | 728.05 |
| IUPAC Name | zinc bis([bis(2,3-dimethylphenyl)-sulfidoazaniumyl]methanedithioate) |
| SMILES | Cc1cccc([N+]([S-])(C(=S)[S-])c2cccc(C)c2C)c1C.Cc1cccc([N+]([S-])(C(=S)[S-])c2cccc(C)c2C)c1C.[Zn+2] |
| InChI | InChI=1S/2C17H19NS3.Zn/c2*1-11-7-5-9-15(13(11)3)18(21,17(19)20)16-10-6-8-12(2)14(16)4;/h2*5-10H,1-4H3,(H,19,20);/q;;+2/p-2 |
| InChIKey | IQTUZUSXQIPFNX-UHFFFAOYSA-L |
| XLogP | 9.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.47 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|