C18H31NO4 — CID 87496777
tert-butyl 2-(2-cyclohexylethyl)-5-formylmorpholine-4-carboxylate (PubChem CID 87496777) has the molecular formula C18H31NO4 and a molecular weight of 325.45 g/mol. Its IUPAC name is tert-butyl 2-(2-cyclohexylethyl)-5-formylmorpholine-4-carboxylate.
| Compound Name | tert-butyl 2-(2-cyclohexylethyl)-5-formylmorpholine-4-carboxylate |
|---|---|
| PubChem CID | 87496777 |
| Molecular Formula | C18H31NO4 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | tert-butyl 2-(2-cyclohexylethyl)-5-formylmorpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(CCC2CCCCC2)OCC1C=O |
| InChI | InChI=1S/C18H31NO4/c1-18(2,3)23-17(21)19-11-16(22-13-15(19)12-20)10-9-14-7-5-4-6-8-14/h12,14-16H,4-11,13H2,1-3H3 |
| InChIKey | XJJZYPXXGBWMMD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|