C9H2F12O9S4 — CID 87537087
(1E,4E)-1,2,4,5-tetrakis(trifluoromethylsulfonyl)penta-1,4-dien-3-one (PubChem CID 87537087) has the molecular formula C9H2F12O9S4 and a molecular weight of 610.35 g/mol. Its IUPAC name is (1E,4E)-1,2,4,5-tetrakis(trifluoromethylsulfonyl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1,2,4,5-tetrakis(trifluoromethylsulfonyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 87537087 |
| Molecular Formula | C9H2F12O9S4 |
| Molecular Weight | 610.35 g/mol |
| Exact Mass | 609.84 |
| IUPAC Name | (1E,4E)-1,2,4,5-tetrakis(trifluoromethylsulfonyl)penta-1,4-dien-3-one |
| SMILES | O=C(/C(=C\S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)/C(=C\S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C9H2F12O9S4/c10-6(11,12)31(23,24)1-3(33(27,28)8(16,17)18)5(22)4(34(29,30)9(19,20)21)2-32(25,26)7(13,14)15/h1-2H/b3-1+,4-2+ |
| InChIKey | MKGOQSXVUJBOKU-ZPUQHVIOSA-N |
| XLogP | 1.98 |
| TPSA | 153.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|