C22H22F2N2O6 — CID 87570214
3-[4-(1,1-difluoroethyl)phenyl]-5-methoxycarbonyl-1-(4-nitrophenyl)piperidin-1-ium-1-carboxylate (PubChem CID 87570214) has the molecular formula C22H22F2N2O6 and a molecular weight of 448.42 g/mol. Its IUPAC name is 3-[4-(1,1-difluoroethyl)phenyl]-5-methoxycarbonyl-1-(4-nitrophenyl)piperidin-1-ium-1-carboxylate.
| Compound Name | 3-[4-(1,1-difluoroethyl)phenyl]-5-methoxycarbonyl-1-(4-nitrophenyl)piperidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 87570214 |
| Molecular Formula | C22H22F2N2O6 |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 3-[4-(1,1-difluoroethyl)phenyl]-5-methoxycarbonyl-1-(4-nitrophenyl)piperidin-1-ium-1-carboxylate |
| SMILES | COC(=O)C1CC(c2ccc(C(C)(F)F)cc2)C[N+](C(=O)[O-])(c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C22H22F2N2O6/c1-22(23,24)17-5-3-14(4-6-17)15-11-16(20(27)32-2)13-26(12-15,21(28)29)19-9-7-18(8-10-19)25(30)31/h3-10,15-16H,11-13H2,1-2H3 |
| InChIKey | OWVUVGCTCIQNSH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 109.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|