1,3,5-trifluorocyclohexa-2,4-diene-1-carbonyl chloride

C7H4ClF3O — CID 87571777

IUPAC1,3,5-trifluorocyclohexa-2,4-diene-1-carbonyl chloride
SMILESO=C(Cl)C1(F)C=C(F)C=C(F)C1
InChIInChI=1S/C7H4ClF3O/c8-6(12)7(11)2-4(9)1-5(10)3-7/h1-2H,3H2
InChIKeyBEFXMTKEWBAOKI-UHFFFAOYSA-N
MW196.56 g/mol
LogP2.57
Rot. Bonds1

About 1,3,5-trifluorocyclohexa-2,4-diene-1-carbonyl chloride

1,3,5-trifluorocyclohexa-2,4-diene-1-carbonyl chloride (PubChem CID 87571777) has the molecular formula C7H4ClF3O and a molecular weight of 196.56 g/mol. Its IUPAC name is 1,3,5-trifluorocyclohexa-2,4-diene-1-carbonyl chloride.

Molecular Properties

Compound Name1,3,5-trifluorocyclohexa-2,4-diene-1-carbonyl chloride
PubChem CID87571777
Molecular FormulaC7H4ClF3O
Molecular Weight196.56 g/mol
Exact Mass195.99
IUPAC Name1,3,5-trifluorocyclohexa-2,4-diene-1-carbonyl chloride
SMILESO=C(Cl)C1(F)C=C(F)C=C(F)C1
InChIInChI=1S/C7H4ClF3O/c8-6(12)7(11)2-4(9)1-5(10)3-7/h1-2H,3H2
InChIKeyBEFXMTKEWBAOKI-UHFFFAOYSA-N
XLogP2.57
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.56
LogP ≤ 52.57
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 1,3,5-trifluorocyclohexa-2,4-diene-1-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3,5-trifluorocyclohexa-2,4-diene-1-carbonyl chloride?
The IUPAC name of 1,3,5-trifluorocyclohexa-2,4-diene-1-carbonyl chloride (CID 87571777) is 1,3,5-trifluorocyclohexa-2,4-diene-1-carbonyl chloride.
What is the SMILES notation for 1,3,5-trifluorocyclohexa-2,4-diene-1-carbonyl chloride?
The canonical SMILES for 1,3,5-trifluorocyclohexa-2,4-diene-1-carbonyl chloride is O=C(Cl)C1(F)C=C(F)C=C(F)C1.
What is the InChIKey of 1,3,5-trifluorocyclohexa-2,4-diene-1-carbonyl chloride?
The InChIKey is BEFXMTKEWBAOKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClF3O/c8-6(12)7(11)2-4(9)1-5(10)3-7/h1-2H,3H2.
What are the key properties of 1,3,5-trifluorocyclohexa-2,4-diene-1-carbonyl chloride?
1,3,5-trifluorocyclohexa-2,4-diene-1-carbonyl chloride has a molecular weight of 196.56 g/mol, XLogP of 2.57, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,5-trifluorocyclohexa-2,4-diene-1-carbonyl chloride is sourced from PubChem (CID 87571777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).