C8H2Cl2F4O2 — CID 172791395
1,4,5,6-tetrafluorocyclohexa-3,5-diene-1,3-dicarbonyl chloride (PubChem CID 172791395) has the molecular formula C8H2Cl2F4O2 and a molecular weight of 277.00 g/mol. Its IUPAC name is 1,4,5,6-tetrafluorocyclohexa-3,5-diene-1,3-dicarbonyl chloride.
| Compound Name | 1,4,5,6-tetrafluorocyclohexa-3,5-diene-1,3-dicarbonyl chloride |
|---|---|
| PubChem CID | 172791395 |
| Molecular Formula | C8H2Cl2F4O2 |
| Molecular Weight | 277.00 g/mol |
| Exact Mass | 275.94 |
| IUPAC Name | 1,4,5,6-tetrafluorocyclohexa-3,5-diene-1,3-dicarbonyl chloride |
| SMILES | O=C(Cl)C1=C(F)C(F)=C(F)C(F)(C(=O)Cl)C1 |
| InChI | InChI=1S/C8H2Cl2F4O2/c9-6(15)2-1-8(14,7(10)16)5(13)4(12)3(2)11/h1H2 |
| InChIKey | PPRZKIGJNIXURE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.00 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|