C18H19BrN4S — CID 87610334
N-benzyl-4-[(3,5-dimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline bromide (PubChem CID 87610334) has the molecular formula C18H19BrN4S and a molecular weight of 403.35 g/mol. Its IUPAC name is N-benzyl-4-[(3,5-dimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline bromide.
| Compound Name | N-benzyl-4-[(3,5-dimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline bromide |
|---|---|
| PubChem CID | 87610334 |
| Molecular Formula | C18H19BrN4S |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | N-benzyl-4-[(3,5-dimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline bromide |
| SMILES | Cc1c[n+](C)c(/N=N/c2ccc(NCc3ccccc3)cc2)s1.[Br-] |
| InChI | InChI=1S/C18H18N4S.BrH/c1-14-13-22(2)18(23-14)21-20-17-10-8-16(9-11-17)19-12-15-6-4-3-5-7-15;/h3-11,13H,12H2,1-2H3;1H |
| InChIKey | RWPKEMKTAXXZRJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|